Urolithin B အမှုန့်

နိုဝင်ဘာလ 9, 2020

Cofttek သည်တရုတ်နိုင်ငံတွင်အကောင်းဆုံး Urolithin B အမှုန့်ထုတ်လုပ်သူဖြစ်သည်။ ကျွန်ုပ်တို့၏စက်ရုံတွင် ၂၀၀ ကီလိုဂရမ်၏လစဉ်ထုတ်လုပ်မှုစွမ်းရည်နှင့်ပြည့်စုံသောထုတ်လုပ်မှုစီမံခန့်ခွဲမှုစနစ် (ISO9001 & ISO14001) ရှိသည်။

 


status: Mass Production အတွက်
ယူနစ်: 1kg / အိတ်, 25kg / စည်

Urolithin BSpecifications

အမည်: Urolithin ခ
ဓာတုအမည်: 3-Hydroxy-6H-dibenzo [ခ၊ ]] pyran-6-one
CAS: 1139-83-9
ဓာတုဖော်မြူလာ: C13H8O3
မော်လီကျူးအလေးချိန်: 212.2 g / mol
အရောင်:  အဖြူရောင်အမှုန့်
InChi သော့ WXUQMTRHPNOXBV-UHFFFAOYSA-N
အပြုံးကုဒ် O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Function ကို: Urolithin B သည် mitochondrial နှင့်ကြွက်သားများကိုကောင်းမွန်စေသည်။

Urolithin B သည်အိုမင်းနေစဉ်ကြွက်သားစွမ်းအားနှင့်ခံနိုင်ရည်ကိုတိုးတက်စေသည်။

လျှောက်လွှာ: Urolithin B သည် ellagitannis ၏အူသိမ်အဏုဇီဝဗေဒဖြစ်မှုဖြစ်သည့်အပြင်အကဲဖြတ်ခြင်းစနစ်နှင့်အခြေအနေများပေါ် မူတည်၍ စွမ်းအားကြီးသော anti-oxidant နှင့် pro-oxidant activies ကိုပြသည်။ Urolithin B သည် estrogenic နှင့် / သို့မဟုတ် anti-estrogenic လှုပ်ရှားမှုများကိုလည်းပြနိုင်သည်။
ပျော်ဝင်: N, N-dimethylformamide နှင့် dimethylmethylene တွင်အလွယ်တကူပျော်ဝင်နိုင်သည်။ Methanol, Ethanol နှင့် Ethyl acetate များတွင်အနည်းငယ်ပျော်ဝင်နိုင်ပါသည်
သိုလှောင်မှုကို Temp: Hygroscopic, -20 အစွမ်းမဲ့လေထုလက်အောက်တွင်ကို C ရေခဲသေတ္တာ°
သင်္ဘောအခြေအနေ Non-အန္တရာယ်ရှိသောဓာတုအဖြစ်အပူချိန်အောက်မှာတင်ပို့။ ဒီထုတ်ကုန်အကောက်ခွန်အတွက်သုံးစွဲသာမန်သင်္ဘောနှင့်အချိန်ကာလအတွင်းရက်သတ္တပတ်အနည်းငယ်အဘို့အလုံလောက်အောင်တည်ငြိမ်ဖြစ်ပါတယ်။

 

Urolithin ခ NMR Spectrum

Urolithin B (၁၁၃၉-၈၃-၉)-NMR Spectrum

 

ထုတ်ကုန်များနှင့်အခြားသတင်းအချက်အလက်များအတွက် COA, MSDS, HNMR လိုအပ်ပါကကျွန်ုပ်တို့နှင့်ဆက်သွယ်ပါ စျေးကွက်ရှာဖွေရေးမန်နေဂျာ.

 

Urolithins မှနိဒါန်း

Urolithins သည် ellagitannins မှဆင်းသက်လာသော ellagic acid ၏ metabolites များဖြစ်သည်။ လူသားများတွင် ellagitannins ကိုအူ microflora မှ ellagic acid အဖြစ်ပြောင်းလဲသည်။ ၎င်းသည်အူမကြီးအတွင်းရှိ urolithins A, urolithin B, urolithin C နှင့် urolithin D အဖြစ်ပြောင်းလဲသည်။

Urolithin A (UA) သည် ellagitannins ၏အများဆုံးပျံ့နှံ့မှု metabolite ဖြစ်သည်။ သို့သော် Uolithin A သည်မည်သည့်အစားအစာအရင်းအမြစ်မှမဆိုသဘာ ၀ တွေ့ရှိနိုင်သည်။

Urolithin B (UB) သည်အူထဲမှထွက်သော ellagitannins ပြောင်းလဲခြင်းမှထွက်ရှိသော metabolite ဖြစ်သည်။ Urolithin B သည်အခြား urolithin အနကျအဓိပ်ပါယျအားလုံးကို catabolized ပြီးနောက်နောက်ဆုံးထုတ်ကုန်ဖြစ်ပါတယ်။ Urolithin B ကိုဆီး၌ urolithin B glucuronide အဖြစ်တွေ့ရှိရသည်။

Urolithin A 8-Methyl Ether သည် Urolithin အေ၏ပေါင်းစပ်စဉ်ကာလအတွင်းအလယ်အလတ်ဖြစ်သောထုတ်ကုန်ဖြစ်သည်။ ၎င်းသည် ellagitannin ၏အဓိကအလယ်အလတ်ဇီဝြဖစ်သည်။

 

urolithin A နှင့် B ၏လုပ်ဆောင်မှုယန္တရား

● Urolithin A သည် mitophagy ကိုဖြစ်ပေါ်စေသည်

Mitophagy သည် autophagy ပုံစံတစ်မျိုးဖြစ်ပြီးပျက်စီးသွားသော mitochondrial ကိုသူတို့၏အကောင်းဆုံးလည်ပတ်မှုအတွက်ဖယ်ရှားပေးသည်။ Autophagy သည် cytoplasmic ပါ ၀ င်သောအရာများအားအဆင့်အတန်းနိမ့်ကျ။ ပြန်လည်သုံးသပ်သောယေဘူယျဖြစ်စဉ်ကိုရည်ညွှန်းသည်။ mitophagy သည် mitochondria ၏ပျက်စီးခြင်းနှင့်ပြန်လည်အသုံးပြုခြင်းဖြစ်သည်။

အိုမင်းနေစဉ်ကာလအတွင်း autophagy လျော့နည်းခြင်းသည် mitochondrial function ကိုကျဆင်းစေသည့်အချက်တစ်ချက်ဖြစ်သည်။ ထို့အပြင် oxidative stress သည် autophagy နည်းစေနိုင်သည်။ Urolithin A သည်ရွေးချယ်သော autophagy မှတဆင့်ပျက်စီးသွားသော mitochondria များကိုဖယ်ရှားနိုင်သည်။

● Antioxidant ဂုဏ်သတ္တိများ

ခန္ဓာကိုယ်ထဲတွင် free radicals နှင့် antioxidant အကြားမညီမမျှဖြစ်သည့်အခါ oxidative stress သည်ဖြစ်ပေါ်သည်။ ဤရွေ့ကားပိုလျှံအခမဲ့အစွန်းရောက်များမကြာခဏထိုကဲ့သို့သောနှလုံးရောဂါ, ဆီးချိုရောဂါနှင့်ကင်ဆာအများအပြားနာတာရှည်ရောဂါများနှင့်ဆက်စပ်လျက်ရှိသည်။

Urolithins A နှင့် B သည် free radicals များနှင့်အထူးသဖြင့် intracellular ဓာတ်ပြုခြင်းအောက်စီဂျင်မျိုးစိတ် (ROS) အဆင့်ကိုလျှော့ချနိုင်သည့်အပြင် antioxidant သက်ရောက်မှုများကိုပြသည်။ အချို့ဆဲလ်အမျိုးအစားများတွင် lipid peroxidation ကိုတားစီးသည်။

ထို့အပြင် urolithins များသည် monoamine oxidase A နှင့် tyrosinase အပါအဝင်အချို့သော oxidating enzymes များကိုတားဆီးနိုင်သည်။

●ရောင်ရမ်းခြင်းဆန့်ကျင်ဂုဏ်သတ္တိများ

ရောင်ရမ်းခြင်းဆိုသည်မှာသဘာဝအလျောက်ဖြစ်စဉ်တစ်ခုဖြစ်သည်၊ ကျွန်ုပ်တို့၏ကိုယ်ခန္ဓာသည်ကူးစက်ခြင်း၊ သို့သော်နာတာရှည်ရောင်ရမ်းခြင်းသည်ကိုယ်ခန္ဓာကိုအန္တရာယ်ဖြစ်စေနိုင်သည်၊ အကြောင်းမှာယင်းသည်ပန်းနာရင်ကျပ်ရောဂါ၊ နှလုံးပြissuesနာနှင့်ကင်ဆာစသောရောဂါအမျိုးမျိုးနှင့်ဆက်နွှယ်နေသောကြောင့်ဖြစ်သည်။ ခန္ဓာကိုယ်အတွင်းရှိကုသမှုမရှိသောစူးရှသောရောင်ရမ်းခြင်း၊ ကူးစက်ခြင်းသို့မဟုတ်အခမဲ့အစွန်းရောက်မှုများကြောင့်နာတာရှည်ရောင်ရမ်းခြင်းဖြစ်နိုင်သည်။

Urolithins A နှင့် B သည်နိုက်ထရစ်အောက်ဆိုဒ်ထုတ်လုပ်မှုကိုဟန့်တားခြင်းဖြင့်ရောင်ရမ်းခြင်းကိုကာကွယ်ပေးသည်။ သူတို့ကအထူးသဖြင့်သွေးကြောအတွက်တာဝန်ရှိသည်သောသွေးဆောင်နိုက်ထရစ်အောက်ဆိုဒ် synthase (iNOS) ပရိုတိန်းနှင့် mRNA ထုတ်ဖော်တားဆီး။

●ပိုးမွှားနှိမ်နင်းခြင်းအကျိုးသက်ရောက်မှုများ

ဘက်တီးရီးယား၊ မှိုများနှင့်ဗိုင်းရပ်စ်များအပါအ ၀ င်ပိုးမွှားများသည်သဘာဝပတ်ဝန်းကျင်နှင့်လူ့ခန္ဓာကိုယ်အတွင်း၌ပင်ဖြစ်ပွားလေ့ရှိသည်။ သို့သော်ရောဂါပိုးများဟုရည်ညွှန်းထားသောရောဂါပိုးအချို့သည်တုပ်ကွေး၊ ဝက်သက်နှင့်ငှက်ဖျားရောဂါကဲ့သို့သောကူးစက်ရောဂါများကိုဖြစ်ပွားစေနိုင်သည်။

Urolithin A နှင့် B သည် quorum sensing ကိုတားဆီးပေးခြင်းဖြင့်ရောဂါပိုးမွှားတိုက်ဖျက်နိုင်စွမ်းကိုပြနိုင်သည်။ Quorum sensing သည်ဗက်တီးရီးယားနှင့်ဆက်သွယ်မှုကဲ့သို့သောရောဂါကူးစက်မှုနှင့်ဆက်စပ်သောဖြစ်စဉ်များကိုဘက်တီးရီးယားများအားစစ်ဆေးရန်နှင့်ထိန်းချုပ်ရန်ဘက်တီးရီးယားဆက်သွယ်မှုနည်းလမ်းတစ်ခုဖြစ်သည်။

●ပရိုတိန်းများဟိုက်လိုက်ခြင်း

Glycation သည် lipid (သို့) ပရိုတိန်းနှင့်သကြားဓာတ်ကို non-enzymatic attachment ကိုရည်ညွှန်းသည်။ ၎င်းသည်ဆီးချိုရောဂါနှင့်အခြားရောဂါများအတွက်အိုမင်းခြင်းအတွက်အဓိကဇီဝကုန်ပစ္စည်းဖြစ်သည်။

မြင့်မားသောပရိုတင်းဂလီကိတ်သည် hyperglycemia ၏ဒုတိယအကျိုးသက်ရောက်မှုတစ်ခုဖြစ်သည်။ ဥပမာဆီးချိုရောဂါနှင့်အယ်လ်ဇိုင်းမားရောဂါကဲ့သို့နှလုံးသွေးကြောဆိုင်ရာဆက်စပ်ရောဂါများတွင်အဓိကအခန်းကဏ္ has ရှိသည်။

Urolithin A နှင့် B သည် anti-glycative ဂုဏ်သတ္တိများကိုထိုးသည်။ ၎င်းသည်ဆေးမှီခိုသော antioxidant လုပ်ဆောင်မှုနှင့်မသက်ဆိုင်ပါ။

 

Urolithin B ၏အကျိုးကျေးဇူးများ

Urolithin B ဖြည့်စွက်ဆေးများသည်ကျန်းမာရေးအကျိုးကျေးဇူးများစွာရရှိထားပြီးအများစုမှာ urolithin A အကျိုးကျေးဇူးများနှင့်ဆင်တူသည်။

(၁) ကင်ဆာရောဂါဖြစ်နိုင်ချေ
urolithin B ၏ရောင်ရမ်းခြင်းကိုဆန့်ကျင်သောဂုဏ်သတ္တိများသည်၎င်းသည်ကင်ဆာကိုတိုက်ဖျက်ရန်ကောင်းမွန်သောအရည်အချင်းတစ်ခုဖြစ်သည်။ သုတေသီအချို့ကဤအလားအလာကို fibroblasts, microphages နှင့် endothelial cells တွင်ဖော်ပြခဲ့သည်။

လေ့လာမှုများအရ UB သည်ဆီးကြိတ်၊ အူမကြီးနှင့်ဆီးအိမ်ကင်ဆာကဲ့သို့သောကင်ဆာအမျိုးမျိုးကိုတားဆီးပေးသည်။

လူ့အူမကြီးကင်ဆာဆဲ (လ်) များပါဝင်သောလေ့လာမှုတစ်ခုတွင် ellagitannins, ellagic acid နှင့် urolithins A နှင့် B တို့ကိုသူတို့၏ကင်ဆာရောဂါဖြစ်နိုင်ခြေအတွက်အကဲဖြတ်ခဲ့သည်။ သူတို့ကကုသမှုအားလုံးသည်ကင်ဆာဆဲလ်များကြီးထွားမှုကိုတားဆီးနိုင်ခဲ့သည်ဟုဆိုသည်။ သူတို့ကကင်ဆာဆဲလ်တွေပွားများမှုကိုတားဆီးပေးတယ်၊

(2) oxidative စိတ်ဖိစီးမှုကိုတွန်းလှန်ရန်ကူညီနိုင်သည်
Urolithin B သည်အချို့သောဆဲလ်အမျိုးအစားများတွင်ဓာတ်ပြုခြင်းအောက်စီဂျင်အမျိုးအစားများနှင့် lipid peroxidation ကိုလျှော့ချပေးခြင်းဖြင့်အလွန်ကောင်းမွန်သော antioxidant ဂုဏ်သတ္တိများကိုပိုင်ဆိုင်သည်။ ROS အဆင့်မြင့်ခြင်းသည်အယ်ဇိုင်းမားရောဂါကဲ့သို့သောရောဂါများစွာနှင့်ဆက်စပ်လျက်ရှိသည်။

အာရုံကြောဆဲလ်များနှင့်ဓါတ်တိုးခြင်းဆိုင်ရာစိတ်ဖိစီးမှုများနှင့်လေ့လာမှုတစ်ခုတွင် urolithin B ဖြည့်စွက်ခြင်းနှင့် urolithin A တို့ကဆဲလ်များကိုဓာတ်တိုးခြင်းမှကာကွယ်ပေးသည်ကိုတွေ့ရှိခဲ့သည်။

(၃) မှတ်ဥာဏ်တိုးမြှင့်နိုင်သည့် Urolithin B
Urolithin b သည်သွေးအတားအဆီးကိုတိုးတက်စေသည်ဟုအစီရင်ခံခဲ့သည်။ ဤသည်သိမြင်မှုလုပ်ငန်းဆောင်တာပိုကောင်းစေတယ်။

လေ့လာမှုများအရ urolithin B သည်ယေဘုယျသိမှုဆိုင်ရာလည်ပတ်မှုကိုတိုးတက်စေခြင်းဖြင့်မှတ်ဥာဏ်ကိုမြှင့်တင်ပေးနိုင်သည်။

(4) ကြွက်သားဆုံးရှုံးမှုကိုကာကွယ်ပေးသည်
ကြွက်သားဆုံးရှုံးမှုသည်ရောဂါများ၊ အိုမင်းခြင်းနှင့်အစားအသောက်တွင်ပရိုတင်းဓာတ်ချို့တဲ့ခြင်းစသည့်အကြောင်းပြချက်အမျိုးမျိုးကြောင့်ဖြစ်ပွားနိုင်သည်။ လေ့ကျင့်ခန်းလုပ်ခြင်း၊ မူးယစ်ဆေးဝါးနှင့်အမိုင်နိုအက်ဆစ်များအပြင်ပိုလီဖင်နောလ်များအပါအ ၀ င်ကြွက်သားဆုံးရှုံးမှုကိုတားဆီးရန်၊ ကန့်သတ်ရန်သို့မဟုတ်ပိုမိုကောင်းမွန်သောကာကွယ်မှုများစွာပြုလုပ်နိုင်သည်။

Urolithins များကို polyphenols များအဖြစ်ခွဲခြားနိုင်သည်။ ကြွက်သားပရိုတိန်းများစုစည်းခြင်းကိုဖြစ်စေခြင်းနှင့်ပျက်စီးခြင်းကိုနှေးကွေးစေခြင်းဖြင့်ကြွက်သားဆုံးရှုံးမှုကိုကာကွယ်ရန်အခန်းကဏ္ play မှပါ ၀ င်သည်။

ကြွက်များနှင့်လေ့လာမှုတွင်ကြွက်သားများကြီးထွားလာသည်နှင့်အမျှ Urolithin B ဖြည့်စွက်ဆေးများသည် ၄ ​​င်းတို့၏ကြွက်သားများဖွံ့ဖြိုးတိုးတက်စေရန်အချိန်အတန်ကြာအုပ်ချုပ်ခဲ့သည်။

(၅) Urolithin B သည်ရောင်ရမ်းခြင်းကိုတိုက်ဖျက်သည်
Urolithin B သည်ရောင်ရမ်းခြင်းအမှတ်အသားများကိုလျှော့ချခြင်းဖြင့်ရောင်ရမ်းခြင်းဆန့်ကျင်သောဂုဏ်သတ္တိရှိသည်။

ကျောက်ကပ်ဆိုင်ရာ Fibrosis ကိုဖြစ်ပေါ်စေသောကြွက်များအားလေ့လာရာတွင် urolithin B သည်ကျောက်ကပ်ကိုပိုမိုကောင်းမွန်စေကြောင်းတွေ့ရှိခဲ့သည်။ ၎င်းသည်ကျောက်ကပ်ဆိုင်ရာလုပ်ဆောင်မှု၊ ကျောက်ကပ်ဆိုင်ရာ shape သုက်ပိုးပုံသဏ္ဌာန်နှင့်ကျောက်ကပ်ဆိုင်ရာဒဏ်ရာအမှတ်အသားများကိုလျှော့ချပေးခဲ့သည်။ ဤသည် UB ကျောက်ကပ်ဆိုင်ရာရောင်ရမ်းခြင်းလျော့ပါးနိုင်ခဲ့သည်ဖော်ပြသည်။

(၆) urolithin A နှင့် B ၏အကျိုးကျေးဇူးများ
Synergistic အကျိုးသက်ရောက်မှုများကို urolithin A နှင့် B ပေါင်းစပ်မှုတို့ဖြင့်သိမှုဆိုင်ရာလုပ်ဆောင်မှုနှင့်စွမ်းရည်တို့တွင်လည်းဖော်ပြခဲ့သည်။ ဒီလေ့လာမှုကဒီပေါင်းစပ်မှုအားစိုးရိမ်ပူပန်ခြင်းသို့မဟုတ်အယ်လ်ဇိုင်းမားရောဂါကဲ့သို့သောစိတ်ဖောက်ပြန်မှုနှင့်ဆက်နွယ်သောရောဂါများကိုကုသရာတွင်သို့မဟုတ်ကာကွယ်ရာတွင်အသုံးပြုနိုင်ကြောင်းဖော်ပြခဲ့သည်။

urolithins နှင့်ဆက်စပ်သောအခြားအကျိုးကျေးဇူးများမှာ;

  • Neuroprotection
  • ဇီဝဖြစ်စဉ် syndrome ရောဂါပိုမိုကောင်းမွန်

 

Urolithin A နှင့် B အစားအစာအရင်းအမြစ်များ

Urolithins များကိုသဘာဝအစားအစာအရင်းအမြစ်များမှမည်သည့်နေရာတွင်တွေ့ရှိနိုင်သည်ကိုမသိရပါ။ ၎င်းတို့သည် ellagitannins မှဆင်းသက်လာသော ellagic acids များကိုအသွင်ပြောင်းခြင်း၏ထုတ်ကုန်တစ်ခုဖြစ်သည်။ Ellagitannins များကိုအူ microbiota အားဖြင့် ellagic acids များအဖြစ်အသွင်ပြောင်းပြီး ellagic acid ကိုအူမကြီးရှိ၎င်း၏ metabolites (urolithins) အဖြစ်သို့ပြောင်းလဲသည်။

Ellagitannins သည်သဘာဝအရင်းအမြစ်များဖြစ်သည့်သလဲသီး၊ စတော်ဘယ်ရီ၊ Raspberry, cloudberries နှင့် BlackBerry၊ Muscadine စပျစ်သီး၊ ဗာဒံသီး၊ ဂူဗာဗာ၊ လက်ဖက်ရည်နှင့်အခွံမာသီး၊ ပိတ်ပင်စည်။

ထို့ကြောင့်ကျွန်ုပ်တို့သည် urolithin A အစားအစာများနှင့် urolithin B အစားအစာများသည် ellagitannin ကြွယ်ဝသောအစားအစာများဖြစ်သည်။ သတိပြုသင့်သည်မှာ ellagitannin ဇီဝရရှိနိုင်မှုမှာအလွန်နည်းပါးသည်။ ၎င်း၏ဒုတိယ metabolites (urolithins) သည်အလွယ်တကူဇီဝရရှိနိုင်သည်။

ယူရိုသီးသန့်ထုတ်ယူမှုနှင့်ထုတ်လုပ်မှုသည်တစ် ဦး ချင်းစီအကြားကွဲပြားခြားနားသည်။ ellagitannins မှပြောင်းလဲခြင်းသည်အူအတွင်းရှိ microbiota အပေါ်တွင်မှီခိုသည်။ ဤပြောင်းလဲခြင်းတွင်ပါ ၀ င်သောတိကျသောဘက်တီးရီးယားများရှိပြီးအချို့သည်မြင့်မားသော၊ အနိမ့်ကျသောသို့မဟုတ်သင့်လျော်သော microbiota မရရှိသောလူတစ် ဦး ချင်းအလိုက်ကွဲပြားသည်။ အစားအစာအရင်းအမြစ်များသည်လည်းသူတို့၏ ellagitannins အဆင့်ကွဲပြားသည်။ ထို့ကြောင့် ellagitannins ၏အလားအလာရှိသောအကျိုးကျေးဇူးများတစ် ဦး ချင်းစီကနေအခြားကွဲပြားခြားနားသည်။

 

Urolithin A နှင့် B ဖြည့်စွက်ချက်များ

Urolithin A ဖြည့်စွက်မှုများအပြင် Urolithin B ဖြည့်စွက်ဆေးများကိုစျေးကွက်တွင် ellagitannin ကြွယ်ဝသောအစားအစာအရင်းအမြစ်ဖြည့်စွက်အဖြစ်အလွယ်တကူတွေ့ရှိနိုင်သည်။ Urolithin A ဖြည့်စွက်များကိုအလွယ်တကူရရှိနိုင်သည်။ အဓိကအားဖြင့်သလဲသီးဖြန့်ဖြူးရောင်းချမှုကိုကျယ်ပြန့်စွာရောင်းချခဲ့ပြီးအောင်မြင်မှုနှင့်အတူအသုံးပြုခဲ့သည်။ ဤဖြည့်စွက်ဆေးများကိုသစ်သီးများသို့မဟုတ်အခွံမာသီးများမှပေါင်းစပ်။ အရည်သို့မဟုတ်အမှုန့်ပုံစံအဖြစ်ဖော်စပ်သည်။

ကွဲပြားခြားနားသောအစားအစာများတွင် ellagitannins အာရုံစူးစိုက်မှုကွာခြားမှုကြောင့်, urolithin ၏ဖောက်သည်များကအစားအစာအရင်းအမြစ်ထည့်သွင်းစဉ်းစားချပြီးဝယ်။ urolithin B အမှုန့် (သို့) အရည်ဖြည့်စွက်စာများအတွက်ရှာဖွေသောအခါတွင်လည်းအလားတူပင်ဖြစ်သည်။

urolithin A အမှုန့် (သို့) B ဖြင့်ပြုလုပ်သောလူ့လက်တွေ့လေ့လာမှုအနည်းငယ်ကဤဖြည့်စွက်ဆေးများသောက်သုံးခြင်းမှပြင်းထန်သောဘေးထွက်ဆိုးကျိုးများကိုမဖော်ပြခဲ့ပါ။

အညွှန်း

  1. Garcia-Muñoz, Cristina; Vaillant, Fabrice (2014-12-02) “ Ellagitannins ၏ Metabolic Fate: ကျန်းမာရေးအတွက်သက်ရောက်မှုများနှင့်တီထွင်ဆန်းသစ်သောလုပ်ဆောင်ချက်အစားအစာများအတွက်သုတေသနအမြင်များ” အစားအစာသိပ္ပံနှင့်အာဟာရဆိုင်ရာဝေဖန်ချက်များ
  2. Bialonska D, Kasimsetty SG, Khan SI, Ferreira D (နိုဝင်ဘာ ၁၁၊ ၂၀၀၉) ။ “ Pomegranate ellagitannins ၏အူလမ်းကြောင်း microbial metabolites များဖြစ်သော Urolithins သည်ဆဲလ်အခြေပြုစစ်ဆေးမှုတွင်အစွမ်းထက် antioxidant လုပ်ဆောင်မှုကိုပြသည်။ J Agric အစားအစာဓာတု။
  3. Bodwell, ဂရေဟမ်; Pottie, Ian; Nandaluru, Penchal (၂၀၁၁) “ ပြောင်းပြန်အီလက်ထရွန်လိုအပ်ချက်-Diels-Alder-based စုစုပေါင်းပေါင်းစပ်မှု Urolithin M2011”