Urolithin B အမှုန့် 1139 83-9-XNUMX) ထုတ်လုပ်သူနှင့်စက်ရုံ

Urolithin B အမှုန့်

နိုဝင်ဘာလ 9, 2020

Urolithin BSpecifications

အမည်: Urolithin ခ
ဓာတုအမည်: 3-Hydroxy-6H-dibenzo [ခ၊ ]] pyran-6-one
CAS: 1139-83-9
ဓာတုဖော်မြူလာ: C13H8O3
မော်လီကျူးအလေးချိန်: 212.2 g / mol
အရောင်:  အဖြူရောင်အမှုန့်
InChi Key: WXUQMTRHPNOXBV-UHFFFAOYSA-N
SMILES Code: O=C1C2=CC=CC=C2C3=CC=C(O)C=C3O1
Function ကို: Urolithin B သည် mitochondrial နှင့်ကြွက်သားများကိုကောင်းမွန်စေသည်။

Urolithin B သည်အိုမင်းနေစဉ်ကြွက်သားစွမ်းအားနှင့်ခံနိုင်ရည်ကိုတိုးတက်စေသည်။

လျှောက်လွှာ: Urolithin B သည် ellagitannis ၏အူသိမ်အဏုဇီဝဗေဒဖြစ်မှုဖြစ်သည့်အပြင်အကဲဖြတ်ခြင်းစနစ်နှင့်အခြေအနေများပေါ် မူတည်၍ စွမ်းအားကြီးသော anti-oxidant နှင့် pro-oxidant activies ကိုပြသည်။ Urolithin B သည် estrogenic နှင့် / သို့မဟုတ် anti-estrogenic လှုပ်ရှားမှုများကိုလည်းပြနိုင်သည်။
ပျော်ဝင်: N, N-dimethylformamide နှင့် dimethylmethylene တွင်အလွယ်တကူပျော်ဝင်နိုင်သည်။ Methanol, Ethanol နှင့် Ethyl acetate များတွင်အနည်းငယ်ပျော်ဝင်နိုင်ပါသည်
သိုလှောင်မှုကို Temp: Hygroscopic, -20 အစွမ်းမဲ့လေထုလက်အောက်တွင်ကို C ရေခဲသေတ္တာ°
သင်္ဘောအခြေအနေ Non-အန္တရာယ်ရှိသောဓာတုအဖြစ်အပူချိန်အောက်မှာတင်ပို့။ ဒီထုတ်ကုန်အကောက်ခွန်အတွက်သုံးစွဲသာမန်သင်္ဘောနှင့်အချိန်ကာလအတွင်းရက်သတ္တပတ်အနည်းငယ်အဘို့အလုံလောက်အောင်တည်ငြိမ်ဖြစ်ပါတယ်။